C23H25NO3S — CID 55884732
N-(3-benzylsulfonylpropyl)-3-naphthalen-2-ylpropanamide (PubChem CID 55884732) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-3-naphthalen-2-ylpropanamide.
| Compound Name | N-(3-benzylsulfonylpropyl)-3-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 55884732 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-3-naphthalen-2-ylpropanamide |
| SMILES | O=C(CCc1ccc2ccccc2c1)NCCCS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H25NO3S/c25-23(14-12-19-11-13-21-9-4-5-10-22(21)17-19)24-15-6-16-28(26,27)18-20-7-2-1-3-8-20/h1-5,7-11,13,17H,6,12,14-16,18H2,(H,24,25) |
| InChIKey | IIYNHNANCWWMHF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|