C20H24N2O5S — CID 55843117
N-(3-benzylsulfonylpropyl)-3-[3-(furan-2-yl)prop-2-enoylamino]propanamide (PubChem CID 55843117) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-3-[3-(furan-2-yl)prop-2-enoylamino]propanamide.
| Compound Name | N-(3-benzylsulfonylpropyl)-3-[3-(furan-2-yl)prop-2-enoylamino]propanamide |
|---|---|
| PubChem CID | 55843117 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-3-[3-(furan-2-yl)prop-2-enoylamino]propanamide |
| SMILES | O=C(C=Cc1ccco1)NCCC(=O)NCCCS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H24N2O5S/c23-19(10-9-18-8-4-14-27-18)22-13-11-20(24)21-12-5-15-28(25,26)16-17-6-2-1-3-7-17/h1-4,6-10,14H,5,11-13,15-16H2,(H,21,24)(H,22,23) |
| InChIKey | SGIYZFRJJIXWSU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|