C14H21N3OS2+2 — CID 171634603
dimethyl-[3-[(2-methylsulfanyl-1,3-benzothiazol-3-ium-6-carbonyl)amino]propyl]azanium (PubChem CID 171634603) has the molecular formula C14H21N3OS2+2 and a molecular weight of 311.48 g/mol. Its IUPAC name is dimethyl-[3-[(2-methylsulfanyl-1,3-benzothiazol-3-ium-6-carbonyl)amino]propyl]azanium.
| Compound Name | dimethyl-[3-[(2-methylsulfanyl-1,3-benzothiazol-3-ium-6-carbonyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 171634603 |
| Molecular Formula | C14H21N3OS2+2 |
| Molecular Weight | 311.48 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | dimethyl-[3-[(2-methylsulfanyl-1,3-benzothiazol-3-ium-6-carbonyl)amino]propyl]azanium |
| SMILES | CSc1[nH+]c2ccc(C(=O)NCCC[NH+](C)C)cc2s1 |
| InChI | InChI=1S/C14H19N3OS2/c1-17(2)8-4-7-15-13(18)10-5-6-11-12(9-10)20-14(16-11)19-3/h5-6,9H,4,7-8H2,1-3H3,(H,15,18)/p+2 |
| InChIKey | PVJGNJQUZYVVIT-UHFFFAOYSA-P |
| XLogP | 0.70 |
| TPSA | 47.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.48 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|