C20H37ClN2O7Si — CID 172552820
dimethyl-[5-[(3,4,5-trimethoxybenzoyl)amino]-3-trimethoxysilylpentyl]azanium chloride (PubChem CID 172552820) has the molecular formula C20H37ClN2O7Si and a molecular weight of 481.06 g/mol. Its IUPAC name is dimethyl-[5-[(3,4,5-trimethoxybenzoyl)amino]-3-trimethoxysilylpentyl]azanium chloride.
| Compound Name | dimethyl-[5-[(3,4,5-trimethoxybenzoyl)amino]-3-trimethoxysilylpentyl]azanium chloride |
|---|---|
| PubChem CID | 172552820 |
| Molecular Formula | C20H37ClN2O7Si |
| Molecular Weight | 481.06 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | dimethyl-[5-[(3,4,5-trimethoxybenzoyl)amino]-3-trimethoxysilylpentyl]azanium chloride |
| SMILES | COc1cc(C(=O)NCCC(CC[NH+](C)C)[Si](OC)(OC)OC)cc(OC)c1OC.[Cl-] |
| InChI | InChI=1S/C20H36N2O7Si.ClH/c1-22(2)12-10-16(30(27-6,28-7)29-8)9-11-21-20(23)15-13-17(24-3)19(26-5)18(14-15)25-4;/h13-14,16H,9-12H2,1-8H3,(H,21,23);1H |
| InChIKey | FWJJUISIXZSSKF-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 88.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.06 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|