C10H14BNO6 — CID 142797913
[4-(2-hydroxyethylcarbamoyl)-2-methoxyphenoxy]boronic acid (PubChem CID 142797913) has the molecular formula C10H14BNO6 and a molecular weight of 255.03 g/mol. Its IUPAC name is [4-(2-hydroxyethylcarbamoyl)-2-methoxyphenoxy]boronic acid.
| Compound Name | [4-(2-hydroxyethylcarbamoyl)-2-methoxyphenoxy]boronic acid |
|---|---|
| PubChem CID | 142797913 |
| Molecular Formula | C10H14BNO6 |
| Molecular Weight | 255.03 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | [4-(2-hydroxyethylcarbamoyl)-2-methoxyphenoxy]boronic acid |
| SMILES | COc1cc(C(=O)NCCO)ccc1OB(O)O |
| InChI | InChI=1S/C10H14BNO6/c1-17-9-6-7(10(14)12-4-5-13)2-3-8(9)18-11(15)16/h2-3,6,13,15-16H,4-5H2,1H3,(H,12,14) |
| InChIKey | JLYVCPNYESZWQR-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.03 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|