C19H22F2N2O6S — CID 46420991
N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide (PubChem CID 46420991) has the molecular formula C19H22F2N2O6S and a molecular weight of 444.46 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 46420991 |
| Molecular Formula | C19H22F2N2O6S |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide |
| SMILES | COc1cc(CNC(=O)c2ccc(OC)c(S(=O)(=O)N(C)C)c2)ccc1OC(F)F |
| InChI | InChI=1S/C19H22F2N2O6S/c1-23(2)30(25,26)17-10-13(6-8-15(17)27-3)18(24)22-11-12-5-7-14(29-19(20)21)16(9-12)28-4/h5-10,19H,11H2,1-4H3,(H,22,24) |
| InChIKey | CQPMCCIMWZXCBR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |