C20H25ClN2O5S2 — CID 24551133
2-[(4-chlorophenyl)sulfonylamino]-N-[2-(4-methoxyphenoxy)ethyl]-4-methylsulfanylbutanamide (PubChem CID 24551133) has the molecular formula C20H25ClN2O5S2 and a molecular weight of 473.02 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-N-[2-(4-methoxyphenoxy)ethyl]-4-methylsulfanylbutanamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-N-[2-(4-methoxyphenoxy)ethyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 24551133 |
| Molecular Formula | C20H25ClN2O5S2 |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-N-[2-(4-methoxyphenoxy)ethyl]-4-methylsulfanylbutanamide |
| SMILES | COc1ccc(OCCNC(=O)C(CCSC)NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H25ClN2O5S2/c1-27-16-5-7-17(8-6-16)28-13-12-22-20(24)19(11-14-29-2)23-30(25,26)18-9-3-15(21)4-10-18/h3-10,19,23H,11-14H2,1-2H3,(H,22,24) |
| InChIKey | FANWMDROGXLTHI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|