C22H28N2O6S2 — CID 24681326
2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[2-(4-methylphenoxy)ethyl]-4-methylsulfanylbutanamide (PubChem CID 24681326) has the molecular formula C22H28N2O6S2 and a molecular weight of 480.61 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[2-(4-methylphenoxy)ethyl]-4-methylsulfanylbutanamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[2-(4-methylphenoxy)ethyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 24681326 |
| Molecular Formula | C22H28N2O6S2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[2-(4-methylphenoxy)ethyl]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccc2c(c1)OCCO2)C(=O)NCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C22H28N2O6S2/c1-16-3-5-17(6-4-16)28-11-10-23-22(25)19(9-14-31-2)24-32(26,27)18-7-8-20-21(15-18)30-13-12-29-20/h3-8,15,19,24H,9-14H2,1-2H3,(H,23,25) |
| InChIKey | MTAHGHXCFHENMZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|