C22H28N4O4S2 — CID 55679141
2-(benzenesulfonamido)-4-methylsulfanyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]butanamide (PubChem CID 55679141) has the molecular formula C22H28N4O4S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-4-methylsulfanyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]butanamide.
| Compound Name | 2-(benzenesulfonamido)-4-methylsulfanyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 55679141 |
| Molecular Formula | C22H28N4O4S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-(benzenesulfonamido)-4-methylsulfanyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]butanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccccc1)C(=O)NCc1ccc(N2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C22H28N4O4S2/c1-31-14-11-20(25-32(29,30)19-5-3-2-4-6-19)22(28)24-15-17-7-9-18(10-8-17)26-13-12-23-21(27)16-26/h2-10,20,25H,11-16H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | IMDOZVYYXZCESY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|