C21H23F3N4O4S — CID 46443231
N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide (PubChem CID 46443231) has the molecular formula C21H23F3N4O4S and a molecular weight of 484.50 g/mol. Its IUPAC name is N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide.
| Compound Name | N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 46443231 |
| Molecular Formula | C21H23F3N4O4S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
| SMILES | CC(NS(=O)(=O)c1ccccc1C(F)(F)F)C(=O)NCc1ccc(N2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C21H23F3N4O4S/c1-14(27-33(31,32)18-5-3-2-4-17(18)21(22,23)24)20(30)26-12-15-6-8-16(9-7-15)28-11-10-25-19(29)13-28/h2-9,14,27H,10-13H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | RXARWROYUNGVDR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|