C13H18BrN3O4S — CID 9166071
N-[(2S)-1-(2-acetylhydrazinyl)-3-methyl-1-oxobutan-2-yl]-4-bromobenzenesulfonamide (PubChem CID 9166071) has the molecular formula C13H18BrN3O4S and a molecular weight of 392.28 g/mol. Its IUPAC name is N-[(2S)-1-(2-acetylhydrazinyl)-3-methyl-1-oxobutan-2-yl]-4-bromobenzenesulfonamide.
| Compound Name | N-[(2S)-1-(2-acetylhydrazinyl)-3-methyl-1-oxobutan-2-yl]-4-bromobenzenesulfonamide |
|---|---|
| PubChem CID | 9166071 |
| Molecular Formula | C13H18BrN3O4S |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | N-[(2S)-1-(2-acetylhydrazinyl)-3-methyl-1-oxobutan-2-yl]-4-bromobenzenesulfonamide |
| SMILES | CC(=O)NNC(=O)[C@@H](NS(=O)(=O)c1ccc(Br)cc1)C(C)C |
| InChI | InChI=1S/C13H18BrN3O4S/c1-8(2)12(13(19)16-15-9(3)18)17-22(20,21)11-6-4-10(14)5-7-11/h4-8,12,17H,1-3H3,(H,15,18)(H,16,19)/t12-/m0/s1 |
| InChIKey | KVXCTVWTPAAIHR-LBPRGKRZSA-N |
| XLogP | 0.92 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|