C14H23BrClN3O3S — CID 119499904
2-[(4-bromophenyl)sulfonylamino]-3-methyl-N-[2-(methylamino)ethyl]butanamide;hydrochloride (PubChem CID 119499904) has the molecular formula C14H23BrClN3O3S and a molecular weight of 428.78 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonylamino]-3-methyl-N-[2-(methylamino)ethyl]butanamide;hydrochloride.
| Compound Name | 2-[(4-bromophenyl)sulfonylamino]-3-methyl-N-[2-(methylamino)ethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119499904 |
| Molecular Formula | C14H23BrClN3O3S |
| Molecular Weight | 428.78 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonylamino]-3-methyl-N-[2-(methylamino)ethyl]butanamide;hydrochloride |
| SMILES | CNCCNC(=O)C(NS(=O)(=O)c1ccc(Br)cc1)C(C)C.Cl |
| InChI | InChI=1S/C14H22BrN3O3S.ClH/c1-10(2)13(14(19)17-9-8-16-3)18-22(20,21)12-6-4-11(15)5-7-12;/h4-7,10,13,16,18H,8-9H2,1-3H3,(H,17,19);1H |
| InChIKey | JJGYKADAEGHCJB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.78 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|