C21H34BrN3O3S — CID 55940674
(2S)-2-[(4-bromophenyl)sulfonylamino]-3-methyl-N-[4-(3-methylpiperidin-1-yl)butyl]butanamide (PubChem CID 55940674) has the molecular formula C21H34BrN3O3S and a molecular weight of 488.49 g/mol. Its IUPAC name is (2S)-2-[(4-bromophenyl)sulfonylamino]-3-methyl-N-[4-(3-methylpiperidin-1-yl)butyl]butanamide.
| Compound Name | (2S)-2-[(4-bromophenyl)sulfonylamino]-3-methyl-N-[4-(3-methylpiperidin-1-yl)butyl]butanamide |
|---|---|
| PubChem CID | 55940674 |
| Molecular Formula | C21H34BrN3O3S |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | (2S)-2-[(4-bromophenyl)sulfonylamino]-3-methyl-N-[4-(3-methylpiperidin-1-yl)butyl]butanamide |
| SMILES | CC1CCCN(CCCCNC(=O)[C@@H](NS(=O)(=O)c2ccc(Br)cc2)C(C)C)C1 |
| InChI | InChI=1S/C21H34BrN3O3S/c1-16(2)20(24-29(27,28)19-10-8-18(22)9-11-19)21(26)23-12-4-5-13-25-14-6-7-17(3)15-25/h8-11,16-17,20,24H,4-7,12-15H2,1-3H3,(H,23,26)/t17?,20-/m0/s1 |
| InChIKey | BSFFNWNFPJFDQY-OZBJMMHXSA-N |
| XLogP | 3.38 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|