C22H35N3O3 — CID 86990783
3-methyl-N-[3-(3-methylpiperidin-1-yl)propyl]-2-[(2-phenoxyacetyl)amino]butanamide (PubChem CID 86990783) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is 3-methyl-N-[3-(3-methylpiperidin-1-yl)propyl]-2-[(2-phenoxyacetyl)amino]butanamide.
| Compound Name | 3-methyl-N-[3-(3-methylpiperidin-1-yl)propyl]-2-[(2-phenoxyacetyl)amino]butanamide |
|---|---|
| PubChem CID | 86990783 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | 3-methyl-N-[3-(3-methylpiperidin-1-yl)propyl]-2-[(2-phenoxyacetyl)amino]butanamide |
| SMILES | CC1CCCN(CCCNC(=O)C(NC(=O)COc2ccccc2)C(C)C)C1 |
| InChI | InChI=1S/C22H35N3O3/c1-17(2)21(24-20(26)16-28-19-10-5-4-6-11-19)22(27)23-12-8-14-25-13-7-9-18(3)15-25/h4-6,10-11,17-18,21H,7-9,12-16H2,1-3H3,(H,23,27)(H,24,26) |
| InChIKey | ZLUGXDZOWWQMHA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|