C24H37N3O4 — CID 55718088
1-[3-methyl-2-[(2-phenoxyacetyl)amino]butanoyl]-N-pentylpiperidine-4-carboxamide (PubChem CID 55718088) has the molecular formula C24H37N3O4 and a molecular weight of 431.58 g/mol. Its IUPAC name is 1-[3-methyl-2-[(2-phenoxyacetyl)amino]butanoyl]-N-pentylpiperidine-4-carboxamide.
| Compound Name | 1-[3-methyl-2-[(2-phenoxyacetyl)amino]butanoyl]-N-pentylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55718088 |
| Molecular Formula | C24H37N3O4 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | 1-[3-methyl-2-[(2-phenoxyacetyl)amino]butanoyl]-N-pentylpiperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(C(=O)C(NC(=O)COc2ccccc2)C(C)C)CC1 |
| InChI | InChI=1S/C24H37N3O4/c1-4-5-9-14-25-23(29)19-12-15-27(16-13-19)24(30)22(18(2)3)26-21(28)17-31-20-10-7-6-8-11-20/h6-8,10-11,18-19,22H,4-5,9,12-17H2,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | ZTWYUGJHRCPWPZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|