C15H23FmN3O8S — CID 59081423
3-amino-2-[[4-[2-[2-(methoxycarbonylamino)ethoxy]ethoxy]phenyl]sulfonylamino]propanoic acid;fermium (PubChem CID 59081423) has the molecular formula C15H23FmN3O8S and a molecular weight of 662.43 g/mol. Its IUPAC name is 3-amino-2-[[4-[2-[2-(methoxycarbonylamino)ethoxy]ethoxy]phenyl]sulfonylamino]propanoic acid;fermium.
| Compound Name | 3-amino-2-[[4-[2-[2-(methoxycarbonylamino)ethoxy]ethoxy]phenyl]sulfonylamino]propanoic acid;fermium |
|---|---|
| PubChem CID | 59081423 |
| Molecular Formula | C15H23FmN3O8S |
| Molecular Weight | 662.43 g/mol |
| Exact Mass | 662.22 |
| IUPAC Name | 3-amino-2-[[4-[2-[2-(methoxycarbonylamino)ethoxy]ethoxy]phenyl]sulfonylamino]propanoic acid;fermium |
| SMILES | COC(=O)NCCOCCOc1ccc(S(=O)(=O)NC(CN)C(=O)O)cc1.[Fm] |
| InChI | InChI=1S/C15H23N3O8S.Fm/c1-24-15(21)17-6-7-25-8-9-26-11-2-4-12(5-3-11)27(22,23)18-13(10-16)14(19)20;/h2-5,13,18H,6-10,16H2,1H3,(H,17,21)(H,19,20); |
| InChIKey | JFRWNQOUSHJUCJ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 166.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.43 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|