C15H18N2O6S — CID 99979688
3-(furan-2-ylmethylsulfamoyl)-4-(3-hydroxypropylamino)benzoic acid (PubChem CID 99979688) has the molecular formula C15H18N2O6S and a molecular weight of 354.38 g/mol. Its IUPAC name is 3-(furan-2-ylmethylsulfamoyl)-4-(3-hydroxypropylamino)benzoic acid.
| Compound Name | 3-(furan-2-ylmethylsulfamoyl)-4-(3-hydroxypropylamino)benzoic acid |
|---|---|
| PubChem CID | 99979688 |
| Molecular Formula | C15H18N2O6S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 3-(furan-2-ylmethylsulfamoyl)-4-(3-hydroxypropylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NCCCO)c(S(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C15H18N2O6S/c18-7-2-6-16-13-5-4-11(15(19)20)9-14(13)24(21,22)17-10-12-3-1-8-23-12/h1,3-5,8-9,16-18H,2,6-7,10H2,(H,19,20) |
| InChIKey | WJLXYQIIVOSYSR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|