C20H28N2O5S — CID 99983421
5-[2-(cyclohexen-1-yl)ethylsulfamoyl]-2-[[(2S)-oxolan-2-yl]methylamino]benzoic acid (PubChem CID 99983421) has the molecular formula C20H28N2O5S and a molecular weight of 408.52 g/mol. Its IUPAC name is 5-[2-(cyclohexen-1-yl)ethylsulfamoyl]-2-[[(2S)-oxolan-2-yl]methylamino]benzoic acid.
| Compound Name | 5-[2-(cyclohexen-1-yl)ethylsulfamoyl]-2-[[(2S)-oxolan-2-yl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 99983421 |
| Molecular Formula | C20H28N2O5S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 5-[2-(cyclohexen-1-yl)ethylsulfamoyl]-2-[[(2S)-oxolan-2-yl]methylamino]benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCCC2=CCCCC2)ccc1NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C20H28N2O5S/c23-20(24)18-13-17(8-9-19(18)21-14-16-7-4-12-27-16)28(25,26)22-11-10-15-5-2-1-3-6-15/h5,8-9,13,16,21-22H,1-4,6-7,10-12,14H2,(H,23,24)/t16-/m0/s1 |
| InChIKey | XHLQKOIGCKIXJC-INIZCTEOSA-N |
| XLogP | 3.14 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|