C20H30N2O4S — CID 132659954
2-[2-(cyclohexen-1-yl)ethylamino]-5-(pentan-2-ylsulfamoyl)benzoic acid (PubChem CID 132659954) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethylamino]-5-(pentan-2-ylsulfamoyl)benzoic acid.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethylamino]-5-(pentan-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 132659954 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethylamino]-5-(pentan-2-ylsulfamoyl)benzoic acid |
| SMILES | CCCC(C)NS(=O)(=O)c1ccc(NCCC2=CCCCC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H30N2O4S/c1-3-7-15(2)22-27(25,26)17-10-11-19(18(14-17)20(23)24)21-13-12-16-8-5-4-6-9-16/h8,10-11,14-15,21-22H,3-7,9,12-13H2,1-2H3,(H,23,24) |
| InChIKey | AGZIWZXEMPESAH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|