C20H26N2O5S — CID 99986088
2-(benzylamino)-5-(3-propan-2-yloxypropylsulfamoyl)benzoic acid (PubChem CID 99986088) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is 2-(benzylamino)-5-(3-propan-2-yloxypropylsulfamoyl)benzoic acid.
| Compound Name | 2-(benzylamino)-5-(3-propan-2-yloxypropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99986088 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-(benzylamino)-5-(3-propan-2-yloxypropylsulfamoyl)benzoic acid |
| SMILES | CC(C)OCCCNS(=O)(=O)c1ccc(NCc2ccccc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H26N2O5S/c1-15(2)27-12-6-11-22-28(25,26)17-9-10-19(18(13-17)20(23)24)21-14-16-7-4-3-5-8-16/h3-5,7-10,13,15,21-22H,6,11-12,14H2,1-2H3,(H,23,24) |
| InChIKey | XHGSGBZDYWWUQN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|