C16H22N2O6S — CID 54082190
methyl (2S)-2-amino-3-[3-(1,3-benzodioxol-5-yl)propanoyloxyamino]-4-methylsulfanylbutanoate (PubChem CID 54082190) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[3-(1,3-benzodioxol-5-yl)propanoyloxyamino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-amino-3-[3-(1,3-benzodioxol-5-yl)propanoyloxyamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 54082190 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | methyl (2S)-2-amino-3-[3-(1,3-benzodioxol-5-yl)propanoyloxyamino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@@H](N)C(CSC)NOC(=O)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H22N2O6S/c1-21-16(20)15(17)11(8-25-2)18-24-14(19)6-4-10-3-5-12-13(7-10)23-9-22-12/h3,5,7,11,15,18H,4,6,8-9,17H2,1-2H3/t11?,15-/m0/s1 |
| InChIKey | MNXCRJCZSGLDFG-MHTVFEQDSA-N |
| XLogP | 0.63 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|