C17H26N4O4 — CID 166468335
2-amino-N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]ethyl]butanediamide (PubChem CID 166468335) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-amino-N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]ethyl]butanediamide.
| Compound Name | 2-amino-N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]ethyl]butanediamide |
|---|---|
| PubChem CID | 166468335 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-amino-N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]ethyl]butanediamide |
| SMILES | CC(Cc1ccc2c(c1)OCO2)N(C)C(C)NC(=O)C(N)CC(N)=O |
| InChI | InChI=1S/C17H26N4O4/c1-10(6-12-4-5-14-15(7-12)25-9-24-14)21(3)11(2)20-17(23)13(18)8-16(19)22/h4-5,7,10-11,13H,6,8-9,18H2,1-3H3,(H2,19,22)(H,20,23) |
| InChIKey | QQJCDCPRMYWGEK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|