C17H19N3O4 — CID 168989861
N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]-1,4-dihydropyridine-3-carboxamide (PubChem CID 168989861) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]-1,4-dihydropyridine-3-carboxamide.
| Compound Name | N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]-1,4-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 168989861 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]-1,4-dihydropyridine-3-carboxamide |
| SMILES | CC(NCNC(=O)C1=CNC=CC1)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H19N3O4/c1-11(19-9-20-17(22)13-3-2-6-18-8-13)16(21)12-4-5-14-15(7-12)24-10-23-14/h2,4-8,11,18-19H,3,9-10H2,1H3,(H,20,22) |
| InChIKey | UCULXXHUJOXPSU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|