C18H23N3O3 — CID 166468432
N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]methyl]-1,4-dihydropyridine-3-carboxamide (PubChem CID 166468432) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]methyl]-1,4-dihydropyridine-3-carboxamide.
| Compound Name | N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]methyl]-1,4-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 166468432 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]methyl]-1,4-dihydropyridine-3-carboxamide |
| SMILES | CC(Cc1ccc2c(c1)OCO2)N(C)CNC(=O)C1=CNC=CC1 |
| InChI | InChI=1S/C18H23N3O3/c1-13(8-14-5-6-16-17(9-14)24-12-23-16)21(2)11-20-18(22)15-4-3-7-19-10-15/h3,5-7,9-10,13,19H,4,8,11-12H2,1-2H3,(H,20,22) |
| InChIKey | ZANRSCPVRWGNBH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|