C22H32N2O3 — CID 174092630
(E)-N-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-ethyl-3-methyl-4-pyrrolidin-1-ylpent-2-enamide (PubChem CID 174092630) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is (E)-N-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-ethyl-3-methyl-4-pyrrolidin-1-ylpent-2-enamide.
| Compound Name | (E)-N-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-ethyl-3-methyl-4-pyrrolidin-1-ylpent-2-enamide |
|---|---|
| PubChem CID | 174092630 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | (E)-N-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-ethyl-3-methyl-4-pyrrolidin-1-ylpent-2-enamide |
| SMILES | CCN(C(=O)/C=C(\C)C(C)N1CCCC1)[C@@H](C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H32N2O3/c1-5-24(22(25)12-16(2)18(4)23-10-6-7-11-23)17(3)13-19-8-9-20-21(14-19)27-15-26-20/h8-9,12,14,17-18H,5-7,10-11,13,15H2,1-4H3/b16-12+/t17-,18?/m0/s1 |
| InChIKey | YGLRIPYIZUAMAZ-UEACNSGKSA-N |
| XLogP | 3.63 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|