C12H16F2N2O — CID 115593148
3-[(3,4-difluorophenyl)methyl]-1,1-diethylurea (PubChem CID 115593148) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)methyl]-1,1-diethylurea.
| Compound Name | 3-[(3,4-difluorophenyl)methyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 115593148 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 3-[(3,4-difluorophenyl)methyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H16F2N2O/c1-3-16(4-2)12(17)15-8-9-5-6-10(13)11(14)7-9/h5-7H,3-4,8H2,1-2H3,(H,15,17) |
| InChIKey | RMTLWLXUIPCKRH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |