C18H31N3O4 — CID 23596950
3-[3-[3-imidazol-1-ylpropyl(methyl)amino]propanoyloxy]butyl butanoate (PubChem CID 23596950) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is 3-[3-[3-imidazol-1-ylpropyl(methyl)amino]propanoyloxy]butyl butanoate.
| Compound Name | 3-[3-[3-imidazol-1-ylpropyl(methyl)amino]propanoyloxy]butyl butanoate |
|---|---|
| PubChem CID | 23596950 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 3-[3-[3-imidazol-1-ylpropyl(methyl)amino]propanoyloxy]butyl butanoate |
| SMILES | CCCC(=O)OCCC(C)OC(=O)CCN(C)CCCn1ccnc1 |
| InChI | InChI=1S/C18H31N3O4/c1-4-6-17(22)24-14-8-16(2)25-18(23)7-12-20(3)10-5-11-21-13-9-19-15-21/h9,13,15-16H,4-8,10-12,14H2,1-3H3 |
| InChIKey | UQJGINATMPKRCR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |