C10H19N3O — CID 62334128
1-[3-imidazol-1-ylpropyl(methyl)amino]propan-2-ol (PubChem CID 62334128) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-[3-imidazol-1-ylpropyl(methyl)amino]propan-2-ol.
| Compound Name | 1-[3-imidazol-1-ylpropyl(methyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 62334128 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1-[3-imidazol-1-ylpropyl(methyl)amino]propan-2-ol |
| SMILES | CC(O)CN(C)CCCn1ccnc1 |
| InChI | InChI=1S/C10H19N3O/c1-10(14)8-12(2)5-3-6-13-7-4-11-9-13/h4,7,9-10,14H,3,5-6,8H2,1-2H3 |
| InChIKey | KMHGYDLNEAOEEP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |