C12H24N4 — CID 107207249
N'-(3-imidazol-1-ylpropyl)-N'-methylpentane-1,5-diamine (PubChem CID 107207249) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is N'-(3-imidazol-1-ylpropyl)-N'-methylpentane-1,5-diamine.
| Compound Name | N'-(3-imidazol-1-ylpropyl)-N'-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 107207249 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | N'-(3-imidazol-1-ylpropyl)-N'-methylpentane-1,5-diamine |
| SMILES | CN(CCCCCN)CCCn1ccnc1 |
| InChI | InChI=1S/C12H24N4/c1-15(8-4-2-3-6-13)9-5-10-16-11-7-14-12-16/h7,11-12H,2-6,8-10,13H2,1H3 |
| InChIKey | KPWWLMOMDXFIPP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|