C21H23F5N2O5 — CID 161430314
6-(2,3,4,5,6-pentafluorophenoxy)carbonyloxyhexyl 5-imidazol-1-ylpentanoate (PubChem CID 161430314) has the molecular formula C21H23F5N2O5 and a molecular weight of 478.41 g/mol. Its IUPAC name is 6-(2,3,4,5,6-pentafluorophenoxy)carbonyloxyhexyl 5-imidazol-1-ylpentanoate.
| Compound Name | 6-(2,3,4,5,6-pentafluorophenoxy)carbonyloxyhexyl 5-imidazol-1-ylpentanoate |
|---|---|
| PubChem CID | 161430314 |
| Molecular Formula | C21H23F5N2O5 |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 6-(2,3,4,5,6-pentafluorophenoxy)carbonyloxyhexyl 5-imidazol-1-ylpentanoate |
| SMILES | O=C(CCCCn1ccnc1)OCCCCCCOC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H23F5N2O5/c22-15-16(23)18(25)20(19(26)17(15)24)33-21(30)32-12-6-2-1-5-11-31-14(29)7-3-4-9-28-10-8-27-13-28/h8,10,13H,1-7,9,11-12H2 |
| InChIKey | ZSJGTFJVFBHMLR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|