About 4-imidazol-1-ylbutyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate
4-imidazol-1-ylbutyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate (PubChem CID 154872835) has the molecular formula C14H19N5O4
and a molecular weight of 321.34 g/mol. Its IUPAC name is 4-imidazol-1-ylbutyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate.
Molecular Properties
| Compound Name | 4-imidazol-1-ylbutyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate |
| PubChem CID | 154872835 |
| Molecular Formula | C14H19N5O4 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4-imidazol-1-ylbutyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate |
| SMILES | Cc1nc([N+](=O)[O-])cn1CCC(=O)OCCCCn1ccnc1 |
| InChI | InChI=1S/C14H19N5O4/c1-12-16-13(19(21)22)10-18(12)7-4-14(20)23-9-3-2-6-17-8-5-15-11-17/h5,8,10-11H,2-4,6-7,9H2,1H3 |
| InChIKey | ZVKDWEWRGQTPLQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 105.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-imidazol-1-ylbutyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazol-1-ylbutyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate?
The IUPAC name of 4-imidazol-1-ylbutyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate (CID 154872835) is 4-imidazol-1-ylbutyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate.
What is the SMILES notation for 4-imidazol-1-ylbutyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate?
The canonical SMILES for 4-imidazol-1-ylbutyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate is Cc1nc([N+](=O)[O-])cn1CCC(=O)OCCCCn1ccnc1.
What is the InChIKey of 4-imidazol-1-ylbutyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate?
The InChIKey is ZVKDWEWRGQTPLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O4/c1-12-16-13(19(21)22)10-18(12)7-4-14(20)23-9-3-2-6-17-8-5-15-11-17/h5,8,10-11H,2-4,6-7,9H2,1H3.
What are the key properties of 4-imidazol-1-ylbutyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate?
4-imidazol-1-ylbutyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate has a molecular weight of 321.34 g/mol, XLogP of 1.71, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazol-1-ylbutyl 3-(2-methyl-4-nitroimidazol-1-yl)propanoate is sourced from PubChem (CID 154872835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).