C13H24ClN5O3 — CID 119586069
N-(1-amino-4-methylpentan-2-yl)-3-(2-methyl-4-nitroimidazol-1-yl)propanamide;hydrochloride (PubChem CID 119586069) has the molecular formula C13H24ClN5O3 and a molecular weight of 333.82 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-3-(2-methyl-4-nitroimidazol-1-yl)propanamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-3-(2-methyl-4-nitroimidazol-1-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119586069 |
| Molecular Formula | C13H24ClN5O3 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-3-(2-methyl-4-nitroimidazol-1-yl)propanamide;hydrochloride |
| SMILES | Cc1nc([N+](=O)[O-])cn1CCC(=O)NC(CN)CC(C)C.Cl |
| InChI | InChI=1S/C13H23N5O3.ClH/c1-9(2)6-11(7-14)16-13(19)4-5-17-8-12(18(20)21)15-10(17)3;/h8-9,11H,4-7,14H2,1-3H3,(H,16,19);1H |
| InChIKey | HBKVNGMWBWZWCW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|