C21H20F2N4O3 — CID 49011641
N-[1,2-bis(3-fluorophenyl)ethyl]-3-(2-methyl-4-nitroimidazol-1-yl)propanamide (PubChem CID 49011641) has the molecular formula C21H20F2N4O3 and a molecular weight of 414.41 g/mol. Its IUPAC name is N-[1,2-bis(3-fluorophenyl)ethyl]-3-(2-methyl-4-nitroimidazol-1-yl)propanamide.
| Compound Name | N-[1,2-bis(3-fluorophenyl)ethyl]-3-(2-methyl-4-nitroimidazol-1-yl)propanamide |
|---|---|
| PubChem CID | 49011641 |
| Molecular Formula | C21H20F2N4O3 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-[1,2-bis(3-fluorophenyl)ethyl]-3-(2-methyl-4-nitroimidazol-1-yl)propanamide |
| SMILES | Cc1nc([N+](=O)[O-])cn1CCC(=O)NC(Cc1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C21H20F2N4O3/c1-14-24-20(27(29)30)13-26(14)9-8-21(28)25-19(16-5-3-7-18(23)12-16)11-15-4-2-6-17(22)10-15/h2-7,10,12-13,19H,8-9,11H2,1H3,(H,25,28) |
| InChIKey | YVFLBVZKCNXREC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|