C14H18N4O3S — CID 94777260
2-(2-methyl-4-nitroimidazol-1-yl)-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]acetamide (PubChem CID 94777260) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is 2-(2-methyl-4-nitroimidazol-1-yl)-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]acetamide.
| Compound Name | 2-(2-methyl-4-nitroimidazol-1-yl)-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]acetamide |
|---|---|
| PubChem CID | 94777260 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-(2-methyl-4-nitroimidazol-1-yl)-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]acetamide |
| SMILES | Cc1nc([N+](=O)[O-])cn1CC(=O)N[C@H](c1cccs1)C(C)C |
| InChI | InChI=1S/C14H18N4O3S/c1-9(2)14(11-5-4-6-22-11)16-13(19)8-17-7-12(18(20)21)15-10(17)3/h4-7,9,14H,8H2,1-3H3,(H,16,19)/t14-/m0/s1 |
| InChIKey | IAIWUAQKQGWGFC-AWEZNQCLSA-N |
| XLogP | 2.67 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|