C40H71N3O5S — CID 165381315
[(Z)-non-2-enyl] 6-[3-imidazol-1-ylpropylsulfanylcarbonyl-(3-oxo-3-pentadecan-8-yloxypropyl)amino]hexanoate (PubChem CID 165381315) has the molecular formula C40H71N3O5S and a molecular weight of 706.09 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 6-[3-imidazol-1-ylpropylsulfanylcarbonyl-(3-oxo-3-pentadecan-8-yloxypropyl)amino]hexanoate.
| Compound Name | [(Z)-non-2-enyl] 6-[3-imidazol-1-ylpropylsulfanylcarbonyl-(3-oxo-3-pentadecan-8-yloxypropyl)amino]hexanoate |
|---|---|
| PubChem CID | 165381315 |
| Molecular Formula | C40H71N3O5S |
| Molecular Weight | 706.09 g/mol |
| Exact Mass | 705.51 |
| IUPAC Name | [(Z)-non-2-enyl] 6-[3-imidazol-1-ylpropylsulfanylcarbonyl-(3-oxo-3-pentadecan-8-yloxypropyl)amino]hexanoate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCN(CCC(=O)OC(CCCCCCC)CCCCCCC)C(=O)SCCCn1ccnc1 |
| InChI | InChI=1S/C40H71N3O5S/c1-4-7-10-13-14-17-23-34-47-38(44)27-21-18-22-31-43(40(46)49-35-24-30-42-33-29-41-36-42)32-28-39(45)48-37(25-19-15-11-8-5-2)26-20-16-12-9-6-3/h17,23,29,33,36-37H,4-16,18-22,24-28,30-32,34-35H2,1-3H3/b23-17- |
| InChIKey | PJQVBOZELBYYQP-QJOMJCCJSA-N |
| XLogP | 11.08 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.09 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|