C39H71N3O5S — CID 170077045
[(Z)-non-2-enyl] 4-[3-(2-methyl-1,2-dihydroimidazol-3-yl)propylsulfanylcarbonyl-(4-oxo-4-tetradecan-7-yloxybutyl)amino]butanoate (PubChem CID 170077045) has the molecular formula C39H71N3O5S and a molecular weight of 694.08 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 4-[3-(2-methyl-1,2-dihydroimidazol-3-yl)propylsulfanylcarbonyl-(4-oxo-4-tetradecan-7-yloxybutyl)amino]butanoate.
| Compound Name | [(Z)-non-2-enyl] 4-[3-(2-methyl-1,2-dihydroimidazol-3-yl)propylsulfanylcarbonyl-(4-oxo-4-tetradecan-7-yloxybutyl)amino]butanoate |
|---|---|
| PubChem CID | 170077045 |
| Molecular Formula | C39H71N3O5S |
| Molecular Weight | 694.08 g/mol |
| Exact Mass | 693.51 |
| IUPAC Name | [(Z)-non-2-enyl] 4-[3-(2-methyl-1,2-dihydroimidazol-3-yl)propylsulfanylcarbonyl-(4-oxo-4-tetradecan-7-yloxybutyl)amino]butanoate |
| SMILES | CCCCCC/C=C\COC(=O)CCCN(CCCC(=O)OC(CCCCCC)CCCCCCC)C(=O)SCCCN1C=CNC1C |
| InChI | InChI=1S/C39H71N3O5S/c1-5-8-11-14-15-17-20-33-46-37(43)26-21-29-42(39(45)48-34-23-31-41-32-28-40-35(41)4)30-22-27-38(44)47-36(24-18-13-10-7-3)25-19-16-12-9-6-2/h17,20,28,32,35-36,40H,5-16,18-19,21-27,29-31,33-34H2,1-4H3/b20-17- |
| InChIKey | OANKAFDXAQHYFS-JZJYNLBNSA-N |
| XLogP | 10.13 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.08 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|