C43H77N3O5S — CID 156861424
[(Z)-non-2-enyl] 6-[3-(2-methylimidazol-1-yl)propylsulfanylcarbonyl-(5-oxo-5-pentadecan-8-yloxypentyl)amino]hexanoate (PubChem CID 156861424) has the molecular formula C43H77N3O5S and a molecular weight of 748.17 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 6-[3-(2-methylimidazol-1-yl)propylsulfanylcarbonyl-(5-oxo-5-pentadecan-8-yloxypentyl)amino]hexanoate.
| Compound Name | [(Z)-non-2-enyl] 6-[3-(2-methylimidazol-1-yl)propylsulfanylcarbonyl-(5-oxo-5-pentadecan-8-yloxypentyl)amino]hexanoate |
|---|---|
| PubChem CID | 156861424 |
| Molecular Formula | C43H77N3O5S |
| Molecular Weight | 748.17 g/mol |
| Exact Mass | 747.56 |
| IUPAC Name | [(Z)-non-2-enyl] 6-[3-(2-methylimidazol-1-yl)propylsulfanylcarbonyl-(5-oxo-5-pentadecan-8-yloxypentyl)amino]hexanoate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCN(CCCCC(=O)OC(CCCCCCC)CCCCCCC)C(=O)SCCCn1ccnc1C |
| InChI | InChI=1S/C43H77N3O5S/c1-5-8-11-14-15-18-26-37-50-41(47)30-22-19-24-33-46(43(49)52-38-27-35-45-36-32-44-39(45)4)34-25-23-31-42(48)51-40(28-20-16-12-9-6-2)29-21-17-13-10-7-3/h18,26,32,36,40H,5-17,19-25,27-31,33-35,37-38H2,1-4H3/b26-18- |
| InChIKey | JIUQKQGCEWNSRT-ITYLOYPMSA-N |
| XLogP | 12.17 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.17 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|