C35H65NO4 — CID 168736547
[(Z)-non-2-enyl] 6-[(4-oxo-4-tridecan-7-yloxybutyl)-prop-1-en-2-ylamino]hexanoate (PubChem CID 168736547) has the molecular formula C35H65NO4 and a molecular weight of 563.91 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 6-[(4-oxo-4-tridecan-7-yloxybutyl)-prop-1-en-2-ylamino]hexanoate.
| Compound Name | [(Z)-non-2-enyl] 6-[(4-oxo-4-tridecan-7-yloxybutyl)-prop-1-en-2-ylamino]hexanoate |
|---|---|
| PubChem CID | 168736547 |
| Molecular Formula | C35H65NO4 |
| Molecular Weight | 563.91 g/mol |
| Exact Mass | 563.49 |
| IUPAC Name | [(Z)-non-2-enyl] 6-[(4-oxo-4-tridecan-7-yloxybutyl)-prop-1-en-2-ylamino]hexanoate |
| SMILES | C=C(C)N(CCCCCC(=O)OC/C=C\CCCCCC)CCCC(=O)OC(CCCCCC)CCCCCC |
| InChI | InChI=1S/C35H65NO4/c1-6-9-12-15-16-17-23-31-39-34(37)27-21-18-22-29-36(32(4)5)30-24-28-35(38)40-33(25-19-13-10-7-2)26-20-14-11-8-3/h17,23,33H,4,6-16,18-22,24-31H2,1-3,5H3/b23-17- |
| InChIKey | DTWUBLNRZVFFFS-QJOMJCCJSA-N |
| XLogP | 10.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.91 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|