C42H75NO4 — CID 168962283
3-pentyloctyl 8-[[8-[2-(1-bicyclo[2.2.2]octanyl)ethoxy]-8-oxooctyl]-prop-2-ynylamino]octanoate (PubChem CID 168962283) has the molecular formula C42H75NO4 and a molecular weight of 658.07 g/mol. Its IUPAC name is 3-pentyloctyl 8-[[8-[2-(1-bicyclo[2.2.2]octanyl)ethoxy]-8-oxooctyl]-prop-2-ynylamino]octanoate.
| Compound Name | 3-pentyloctyl 8-[[8-[2-(1-bicyclo[2.2.2]octanyl)ethoxy]-8-oxooctyl]-prop-2-ynylamino]octanoate |
|---|---|
| PubChem CID | 168962283 |
| Molecular Formula | C42H75NO4 |
| Molecular Weight | 658.07 g/mol |
| Exact Mass | 657.57 |
| IUPAC Name | 3-pentyloctyl 8-[[8-[2-(1-bicyclo[2.2.2]octanyl)ethoxy]-8-oxooctyl]-prop-2-ynylamino]octanoate |
| SMILES | C#CCN(CCCCCCCC(=O)OCCC(CCCCC)CCCCC)CCCCCCCC(=O)OCCC12CCC(CC1)CC2 |
| InChI | InChI=1S/C42H75NO4/c1-4-7-15-21-38(22-16-8-5-2)28-36-46-40(44)23-17-11-9-13-19-34-43(33-6-3)35-20-14-10-12-18-24-41(45)47-37-32-42-29-25-39(26-30-42)27-31-42/h3,38-39H,4-5,7-37H2,1-2H3 |
| InChIKey | MOUZTALQQYSEIW-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.07 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|