C18H25NO3S — CID 174453744
(2-thiocyanatoacetyl) 2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methylidene]butanoate (PubChem CID 174453744) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is (2-thiocyanatoacetyl) 2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methylidene]butanoate.
| Compound Name | (2-thiocyanatoacetyl) 2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methylidene]butanoate |
|---|---|
| PubChem CID | 174453744 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (2-thiocyanatoacetyl) 2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methylidene]butanoate |
| SMILES | CCC(=CC1C[C@H]2CC[C@@]1(C)C2(C)C)C(=O)OC(=O)CSC#N |
| InChI | InChI=1S/C18H25NO3S/c1-5-12(16(21)22-15(20)10-23-11-19)8-14-9-13-6-7-18(14,4)17(13,2)3/h8,13-14H,5-7,9-10H2,1-4H3/t13-,14?,18-/m1/s1 |
| InChIKey | AUWQDDAAAUGEBB-VZGYSGOJSA-N |
| XLogP | 4.07 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|