C16H23NO2S — CID 174418190
[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-thiocyanatopent-2-enoate (PubChem CID 174418190) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is [(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-thiocyanatopent-2-enoate.
| Compound Name | [(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-thiocyanatopent-2-enoate |
|---|---|
| PubChem CID | 174418190 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | [(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-thiocyanatopent-2-enoate |
| SMILES | CCC=C(SC#N)C(=O)OC1C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C16H23NO2S/c1-5-6-12(20-10-17)14(18)19-13-9-11-7-8-16(13,4)15(11,2)3/h6,11,13H,5,7-9H2,1-4H3/t11-,13?,16-/m1/s1 |
| InChIKey | GOTWYXRMEMBOSH-UJBKNGIVSA-N |
| XLogP | 4.25 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|