C18H29NO4S — CID 174747103
2-thiocyanatoacetic acid;[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate (PubChem CID 174747103) has the molecular formula C18H29NO4S and a molecular weight of 355.50 g/mol. Its IUPAC name is 2-thiocyanatoacetic acid;[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate.
| Compound Name | 2-thiocyanatoacetic acid;[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 174747103 |
| Molecular Formula | C18H29NO4S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2-thiocyanatoacetic acid;[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1C[C@H]2CC[C@@]1(C)C2(C)C.N#CSCC(=O)O |
| InChI | InChI=1S/C15H26O2.C3H3NO2S/c1-6-10(2)13(16)17-12-9-11-7-8-15(12,5)14(11,3)4;4-2-7-1-3(5)6/h10-12H,6-9H2,1-5H3;1H2,(H,5,6)/t10?,11-,12?,15-;/m1./s1 |
| InChIKey | TVXWOHUAEVIVJJ-FVRZLUNCSA-N |
| XLogP | 4.08 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|