C15H27NO2 — CID 107565787
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (2S)-2-aminopentanoate (PubChem CID 107565787) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (2S)-2-aminopentanoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (2S)-2-aminopentanoate |
|---|---|
| PubChem CID | 107565787 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (2S)-2-aminopentanoate |
| SMILES | CCC[C@H](N)C(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C15H27NO2/c1-5-6-11(16)13(17)18-12-9-10-7-8-15(12,4)14(10,2)3/h10-12H,5-9,16H2,1-4H3/t10?,11-,12?,15?/m0/s1 |
| InChIKey | GRYHUYFSLXBNBE-KZFIADSXSA-N |
| XLogP | 2.87 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |