C13H21BrO3 — CID 166031079
[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-bromo-3-hydroxypropanoate (PubChem CID 166031079) has the molecular formula C13H21BrO3 and a molecular weight of 305.21 g/mol. Its IUPAC name is [(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-bromo-3-hydroxypropanoate.
| Compound Name | [(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-bromo-3-hydroxypropanoate |
|---|---|
| PubChem CID | 166031079 |
| Molecular Formula | C13H21BrO3 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | [(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-bromo-3-hydroxypropanoate |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@H](OC(=O)C(Br)CO)C2 |
| InChI | InChI=1S/C13H21BrO3/c1-12(2)8-4-5-13(12,3)10(6-8)17-11(16)9(14)7-15/h8-10,15H,4-7H2,1-3H3/t8-,9?,10+,13-/m0/s1 |
| InChIKey | LGTDZJRMKQMDHA-MWHZGQMISA-N |
| XLogP | 2.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|