C40H72O8 — CID 165064502
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-5,5-dimethoxy-4-methylpentanoate (PubChem CID 165064502) has the molecular formula C40H72O8 and a molecular weight of 681.01 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-5,5-dimethoxy-4-methylpentanoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-5,5-dimethoxy-4-methylpentanoate |
|---|---|
| PubChem CID | 165064502 |
| Molecular Formula | C40H72O8 |
| Molecular Weight | 681.01 g/mol |
| Exact Mass | 680.52 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-5,5-dimethoxy-4-methylpentanoate |
| SMILES | CCC(CC(C)C(OC)OC)C(=O)OC1CC2CCC1(C)C2(C)C.CCC(CC(C)C(OC)OC)C(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/2C20H36O4/c2*1-8-14(11-13(2)18(22-6)23-7)17(21)24-16-12-15-9-10-20(16,5)19(15,3)4/h2*13-16,18H,8-12H2,1-7H3 |
| InChIKey | RSYIOVSPJOGPKS-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.01 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|