C15H20ClNO6S — CID 174393297
2-O-chloro 1-O-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] oxalate;2-thiocyanatoacetic acid (PubChem CID 174393297) has the molecular formula C15H20ClNO6S and a molecular weight of 377.85 g/mol. Its IUPAC name is 2-O-chloro 1-O-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] oxalate;2-thiocyanatoacetic acid.
| Compound Name | 2-O-chloro 1-O-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] oxalate;2-thiocyanatoacetic acid |
|---|---|
| PubChem CID | 174393297 |
| Molecular Formula | C15H20ClNO6S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 2-O-chloro 1-O-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] oxalate;2-thiocyanatoacetic acid |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)C(OC(=O)C(=O)OCl)C2.N#CSCC(=O)O |
| InChI | InChI=1S/C12H17ClO4.C3H3NO2S/c1-11(2)7-4-5-12(11,3)8(6-7)16-9(14)10(15)17-13;4-2-7-1-3(5)6/h7-8H,4-6H2,1-3H3;1H2,(H,5,6)/t7-,8?,12-;/m1./s1 |
| InChIKey | SNEARHPLKVHXRB-KFEJJNIHSA-N |
| XLogP | 2.73 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|