C13H19NO2S — CID 118693007
2-thiocyanato-2-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetic acid (PubChem CID 118693007) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-thiocyanato-2-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetic acid.
| Compound Name | 2-thiocyanato-2-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetic acid |
|---|---|
| PubChem CID | 118693007 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-thiocyanato-2-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetic acid |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](C(SC#N)C(=O)O)C2 |
| InChI | InChI=1S/C13H19NO2S/c1-12(2)8-4-5-13(12,3)9(6-8)10(11(15)16)17-7-14/h8-10H,4-6H2,1-3H3,(H,15,16)/t8-,9+,10?,13+/m1/s1 |
| InChIKey | UTPUEOHQSXIUEI-WNOSKNQISA-N |
| XLogP | 3.12 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|