C17H27NO4 — CID 174106356
(ethoxycarbonylamino) 2-methyl-3-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-enoate (PubChem CID 174106356) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is (ethoxycarbonylamino) 2-methyl-3-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-enoate.
| Compound Name | (ethoxycarbonylamino) 2-methyl-3-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-enoate |
|---|---|
| PubChem CID | 174106356 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (ethoxycarbonylamino) 2-methyl-3-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]prop-2-enoate |
| SMILES | CCOC(=O)NOC(=O)C(C)=CC1C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C17H27NO4/c1-6-21-15(20)18-22-14(19)11(2)9-13-10-12-7-8-17(13,5)16(12,3)4/h9,12-13H,6-8,10H2,1-5H3,(H,18,20)/t12-,13?,17-/m1/s1 |
| InChIKey | YZNCQHNUVBCRNG-HTCLMOQTSA-N |
| XLogP | 3.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|