C15H24O5 — CID 146230817
1-[[(1S,2R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxycarbonyloxy]ethyl acetate (PubChem CID 146230817) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is 1-[[(1S,2R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxycarbonyloxy]ethyl acetate.
| Compound Name | 1-[[(1S,2R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxycarbonyloxy]ethyl acetate |
|---|---|
| PubChem CID | 146230817 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1-[[(1S,2R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxycarbonyloxy]ethyl acetate |
| SMILES | CC(=O)OC(C)OC(=O)O[C@@H]1CC2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C15H24O5/c1-9(16)18-10(2)19-13(17)20-12-8-11-6-7-15(12,5)14(11,3)4/h10-12H,6-8H2,1-5H3/t10?,11?,12-,15-/m1/s1 |
| InChIKey | RRGZMBVBJGSKSO-WKQXJPDBSA-N |
| XLogP | 3.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|