C13H20O5 — CID 175439549
2-methylidenebutanoic acid;oxolan-2-ylmethyl prop-2-enoate (PubChem CID 175439549) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-methylidenebutanoic acid;oxolan-2-ylmethyl prop-2-enoate.
| Compound Name | 2-methylidenebutanoic acid;oxolan-2-ylmethyl prop-2-enoate |
|---|---|
| PubChem CID | 175439549 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-methylidenebutanoic acid;oxolan-2-ylmethyl prop-2-enoate |
| SMILES | C=C(CC)C(=O)O.C=CC(=O)OCC1CCCO1 |
| InChI | InChI=1S/C8H12O3.C5H8O2/c1-2-8(9)11-6-7-4-3-5-10-7;1-3-4(2)5(6)7/h2,7H,1,3-6H2;2-3H2,1H3,(H,6,7) |
| InChIKey | YXOZFCYUPWRZJA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|